Continentalic acid
Modify Date: 2025-08-25 19:25:56
Continentalic acid structure
|
Common Name | Continentalic acid | ||
|---|---|---|---|---|
| CAS Number | 19889-23-7 | Molecular Weight | 302.5 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H30O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Continentalic acidContinentalic acid from Aralia continentalis has minimum inhibitory concentrations (MICs) of approximately 8-16 µg/mL against S. aureus, including the Methicillin susceptible Staphylococcus aureus (MSSA) and Methicillin-resistant Staphylococcus aureus (MRSA) standard strains[1]. |
| Name | Continentalic acid |
|---|
| Description | Continentalic acid from Aralia continentalis has minimum inhibitory concentrations (MICs) of approximately 8-16 µg/mL against S. aureus, including the Methicillin susceptible Staphylococcus aureus (MSSA) and Methicillin-resistant Staphylococcus aureus (MRSA) standard strains[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C20H30O2 |
|---|---|
| Molecular Weight | 302.5 |
| InChIKey | MHVJRKBZMUDEEV-XIHRTOKZSA-N |
| SMILES | C=CC1(C)C=C2CCC3C(C)(C(=O)O)CCCC3(C)C2CC1 |
| Storage condition | 2-8℃ |