(2S)-N-(Boc)-4-oxopipecolic acid structure
|
Common Name | (2S)-N-(Boc)-4-oxopipecolic acid | ||
|---|---|---|---|---|
| CAS Number | 198646-60-5 | Molecular Weight | 243.256 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 403.6±45.0 °C at 760 mmHg | |
| Molecular Formula | C11H17NO5 | Melting Point | 126-128ºC | |
| MSDS | Chinese USA | Flash Point | 197.9±28.7 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 1-(tert-Butoxycarbonyl)-4-oxopiperidine-2-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 403.6±45.0 °C at 760 mmHg |
| Melting Point | 126-128ºC |
| Molecular Formula | C11H17NO5 |
| Molecular Weight | 243.256 |
| Flash Point | 197.9±28.7 °C |
| Exact Mass | 243.110672 |
| PSA | 83.91000 |
| LogP | -0.08 |
| Vapour Pressure | 0.0±2.0 mmHg at 25°C |
| Index of Refraction | 1.508 |
| InChIKey | GPBCBXYUAJQMQM-QMMMGPOBSA-M |
| SMILES | CC(C)(C)OC(=O)N1CCC(=O)CC1C(=O)[O-] |
| Storage condition | 2-8°C |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H319 |
| Precautionary Statements | P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi |
| RIDADR | NONH for all modes of transport |
| HS Code | 2933399090 |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| (2S)-1-{[(2-Methyl-2-propanyl)oxy]carbonyl}-4-oxo-2-piperidinecarboxylic acid |
| (2S)-N-(Boc)-4-oxopipecolic acid |
| 1,2-Piperidinedicarboxylic acid, 4-oxo-, 1-(1,1-dimethylethyl) ester, (2S)- |