Methyl cyclopentylphenylglycolate structure
|
Common Name | Methyl cyclopentylphenylglycolate | ||
|---|---|---|---|---|
| CAS Number | 19833-96-6 | Molecular Weight | 234.291 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 357.5±22.0 °C at 760 mmHg | |
| Molecular Formula | C14H18O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 147.7±15.1 °C | |
| Name | Methyl α-Cyclopentylmandelate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 357.5±22.0 °C at 760 mmHg |
| Molecular Formula | C14H18O3 |
| Molecular Weight | 234.291 |
| Flash Point | 147.7±15.1 °C |
| Exact Mass | 234.125595 |
| PSA | 46.53000 |
| LogP | 2.74 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.551 |
| InChIKey | FGMUSNHTKNGVQD-UHFFFAOYSA-N |
| SMILES | COC(=O)C(O)(c1ccccc1)C1CCCC1 |
| Storage condition | Refrigerator |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2918199090 |
|
~62%
Methyl cyclopen... CAS#:19833-96-6 |
| Literature: Bodor, Nicholas S. Patent: US2007/123557 A1, 2007 ; Location in patent: Page/Page column 9 ; US 20070123557 A1 |
|
~%
Methyl cyclopen... CAS#:19833-96-6 |
| Literature: US6028198 A1, ; |
|
~75%
Methyl cyclopen... CAS#:19833-96-6 |
| Literature: Institute of Pharmacology and Toxicology Academy of Military Sciences P.L.A. Patent: US6028198 A1, 2000 ; |
|
~%
Methyl cyclopen... CAS#:19833-96-6 |
| Literature: Organic Process Research and Development, , vol. 16, # 11 p. 1754 - 1769 |
| Precursor 5 | |
|---|---|
| DownStream 4 | |
| HS Code | 2918199090 |
|---|---|
| Summary | 2918199090 other carboxylic acids with alcohol function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| Benzeneacetic acid, α-cyclopentyl-α-hydroxy-, methyl ester |
| Methylcyclopentyl(hydroxy)phenylacetat |
| MFCD00019295 |
| Methyl cyclopentyl(hydroxy)phenylacetate |
| EINECS 243-359-0 |
| Methyl cyclopentylphenylglycolate |
| UNII:QUE5YDO74D |