6-CHLORO-5-NITROPYRIDIN-2(1H)-ONE structure
|
Common Name | 6-CHLORO-5-NITROPYRIDIN-2(1H)-ONE | ||
|---|---|---|---|---|
| CAS Number | 198268-98-3 | Molecular Weight | 174.542 | |
| Density | 1.6±0.1 g/cm3 | Boiling Point | 285.4±40.0 °C at 760 mmHg | |
| Molecular Formula | C5H3ClN2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 126.4±27.3 °C | |
| Name | 6-chloro-5-nitro-1H-pyridin-2-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Boiling Point | 285.4±40.0 °C at 760 mmHg |
| Molecular Formula | C5H3ClN2O3 |
| Molecular Weight | 174.542 |
| Flash Point | 126.4±27.3 °C |
| Exact Mass | 173.983215 |
| PSA | 78.94000 |
| LogP | -0.88 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.603 |
| InChIKey | DOWNGLMVNBZIBG-UHFFFAOYSA-N |
| SMILES | O=c1ccc([N+](=O)[O-])c(Cl)[nH]1 |
| Storage condition | 2-8°C |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2933399090 |
|
~73%
6-CHLORO-5-NITR... CAS#:198268-98-3 |
| Literature: ASTRAZENECA AB; ASTRAZENECA UK LIMITED Patent: WO2009/24821 A2, 2009 ; Location in patent: Page/Page column 142-143 ; WO 2009/024821 A2 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 6-Chloro-5-nitro-2(1H)-pyridinone |
| 2(1H)-Pyridinone, 6-chloro-5-nitro- |
| 6-chloro-5-nitropyridin-2-ol |
| 2-Chloro-3-nitro-6-hydroxypyridine |
| 6-Chloro-5-nitropyridin-2(1H)-one |