n-hexanoyl-d-glucosamine
Modify Date: 2025-08-26 08:49:52
n-hexanoyl-d-glucosamine structure
|
Common Name | n-hexanoyl-d-glucosamine | ||
|---|---|---|---|---|
| CAS Number | 19817-88-0 | Molecular Weight | 277.31400 | |
| Density | 1.3g/cm3 | Boiling Point | 578.6ºC at 760 mmHg | |
| Molecular Formula | C12H23NO6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 303.8ºC | |
Use of n-hexanoyl-d-glucosamineN-Hexanoyl-D-glucosamine is a biochemical reagent that can be used as a biological material or organic compound for life science related research. |
| Name | n-hexanoyl-d-glucosamine |
|---|---|
| Synonym | More Synonyms |
| Description | N-Hexanoyl-D-glucosamine is a biochemical reagent that can be used as a biological material or organic compound for life science related research. |
|---|---|
| Related Catalog |
| Density | 1.3g/cm3 |
|---|---|
| Boiling Point | 578.6ºC at 760 mmHg |
| Molecular Formula | C12H23NO6 |
| Molecular Weight | 277.31400 |
| Flash Point | 303.8ºC |
| Exact Mass | 277.15300 |
| PSA | 119.25000 |
| Vapour Pressure | 8.46E-16mmHg at 25°C |
| Index of Refraction | 98 ° (C=1, Pyridine) |
| InChIKey | QLZZYPWIRVQENX-CNVPUSNMSA-N |
| SMILES | CCCCCC(=O)NC(C=O)C(O)C(O)C(O)CO |
| HS Code | 2924199090 |
|---|
| Precursor 2 | |
|---|---|
| DownStream 0 | |
CAS#:3416-24-8
CAS#:2051-49-2| HS Code | 2924199090 |
|---|---|
| Summary | 2924199090. other acyclic amides (including acyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Hexanoylglucosamine |
| 2-Hexanoylamino-2-desoxy-D-glucose |
| 2-DEOXY-2-HEXANAMIDO-D-GLUCOPYRANOSE |
| N-Caproyl-D-glucosamine |
| N-D-Glucose-2-yl-hexamid |
| 2-hexanoylamino-2-deoxy-D-glucose |
| N-Hexanoyl-D-glucosaMine |