Glyceric acid 1,3-biphosphate
Modify Date: 2025-08-20 18:35:03
Glyceric acid 1,3-biphosphate structure
|
Common Name | Glyceric acid 1,3-biphosphate | ||
|---|---|---|---|---|
| CAS Number | 1981-49-3 | Molecular Weight | 266.037 | |
| Density | 2.1±0.1 g/cm3 | Boiling Point | 638.7±65.0 °C at 760 mmHg | |
| Molecular Formula | C3H8O10P2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 340.0±34.3 °C | |
Use of Glyceric acid 1,3-biphosphate1,3-Diphosphoglycerate is 3-carbon organic. 1,3-Diphosphoglycerate is an anhydride of a carboxylic acid and phosphoric acid[1]. |
| Name | phosphono 2-hydroxy-3-phosphonooxypropanoate |
|---|---|
| Synonym | More Synonyms |
| Description | 1,3-Diphosphoglycerate is 3-carbon organic. 1,3-Diphosphoglycerate is an anhydride of a carboxylic acid and phosphoric acid[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 2.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 638.7±65.0 °C at 760 mmHg |
| Molecular Formula | C3H8O10P2 |
| Molecular Weight | 266.037 |
| Flash Point | 340.0±34.3 °C |
| Exact Mass | 265.959259 |
| PSA | 190.44000 |
| LogP | -3.58 |
| Vapour Pressure | 0.0±4.3 mmHg at 25°C |
| Index of Refraction | 1.572 |
| InChIKey | LJQLQCAXBUHEAZ-UHFFFAOYSA-N |
| SMILES | O=C(OP(=O)(O)O)C(O)COP(=O)(O)O |
| 2-Hydroxy-1-oxo-1,3-propanediyl bis[dihydrogen (phosphate)] |
| P-glyceroyl-P |
| 1,3-diphosphoglycerate |
| 1,3-Bisphosphoglycerate |
| 1,3-Bisphosphoglyceric acid |
| 1,3-Diphosphoglycerinsaeure |
| 1,3-biphosphoglycerate |
| 1-Propanone, 2-hydroxy-1,3-bis(phosphonooxy)- |
| glycerate 1,3-biphosphate |
| Glyceric acid-1,3-diphosphate |
| 3-Phosphoglyceroyl phosphate |
| 3-Phosphoglyceroyl-phosphat |
| glyceric acid 1,3-biphosphate |
| 1,3-Biphosphoglyceric acid |
| Glyceric acid 1,3-biphosphic acid |