4,6-Dichloro-2-(methylsulfanyl)-5-nitropyrimidine structure
|
Common Name | 4,6-Dichloro-2-(methylsulfanyl)-5-nitropyrimidine | ||
|---|---|---|---|---|
| CAS Number | 1979-96-0 | Molecular Weight | 240.067 | |
| Density | 1.7±0.1 g/cm3 | Boiling Point | 360.4±37.0 °C at 760 mmHg | |
| Molecular Formula | C5H3Cl2N3O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 171.8±26.5 °C | |
| Name | 4,6-dichloro-2-methylsulfanyl-5-nitropyrimidine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.7±0.1 g/cm3 |
|---|---|
| Boiling Point | 360.4±37.0 °C at 760 mmHg |
| Molecular Formula | C5H3Cl2N3O2S |
| Molecular Weight | 240.067 |
| Flash Point | 171.8±26.5 °C |
| Exact Mass | 238.932297 |
| PSA | 96.90000 |
| LogP | 2.54 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.641 |
| InChIKey | GHAWBARMICSLQS-UHFFFAOYSA-N |
| SMILES | CSc1nc(Cl)c([N+](=O)[O-])c(Cl)n1 |
| Storage condition | 2-8°C |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2933599090 |
|
~94%
4,6-Dichloro-2-... CAS#:1979-96-0 |
| Literature: Brinkman, John A.; Cheung, Adrian Wai-Hing; Firooznia, Fariborz; Guertin, Kevin Richard; Marcopulos, Nicholas; Qi, Lida; Racha, Jagdish Kumar; Sarabu, Ramakanth; Tan, Jenny; Tilley, Jefferson Wright Patent: US2007/270433 A1, 2007 ; Location in patent: Page/Page column 51 ; US 20070270433 A1 |
|
~%
4,6-Dichloro-2-... CAS#:1979-96-0 |
| Literature: WO2011/119518 A1, ; |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4,6-dichloro-2-(methylthio)-5-nitropyrimidine |
| ZLD0499 |
| 4,6-Dichloro-2-(methylsulfanyl)-5-nitropyrimidine |
| 2-methylmercapto-4,6-dichloro-5-nitropyrimidine |
| Pyrimidine, 4,6-dichloro-2-(methylthio)-5-nitro- |
| Pyrimidine,4,6-dichloro-2-(methylthio)-5-nitro |
| 2-methylthio-4,6-dichloro-5-nitro-pyrimidine |
| 4,6-dichloro-2-methylsulfanyl-5-nitro-pyrimidine |
| dichloropyrimidine |