Farglitazar structure
|
Common Name | Farglitazar | ||
|---|---|---|---|---|
| CAS Number | 196808-45-4 | Molecular Weight | 546.61200 | |
| Density | N/A | Boiling Point | 793.7ºC at 760 mmHg | |
| Molecular Formula | C34H30N2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 433.8ºC | |
Use of FarglitazarFarglitazar is a PPARγ agonist that has significant therapeutic benefits such as glycemic control in type 2 diabetic patients. |
| Name | (2S)-2-(2-benzoylanilino)-3-[4-[2-(5-methyl-2-phenyl-1,3-oxazol-4-yl)ethoxy]phenyl]propanoic acid |
|---|---|
| Synonym | More Synonyms |
| Description | Farglitazar is a PPARγ agonist that has significant therapeutic benefits such as glycemic control in type 2 diabetic patients. |
|---|---|
| Related Catalog | |
| References |
| Boiling Point | 793.7ºC at 760 mmHg |
|---|---|
| Molecular Formula | C34H30N2O5 |
| Molecular Weight | 546.61200 |
| Flash Point | 433.8ºC |
| Exact Mass | 546.21500 |
| PSA | 101.66000 |
| LogP | 6.68330 |
| Vapour Pressure | 1.45E-26mmHg at 25°C |
| Index of Refraction | 1.639 |
| InChIKey | ZZCHHVUQYRMYLW-HKBQPEDESA-N |
| SMILES | Cc1oc(-c2ccccc2)nc1CCOc1ccc(CC(Nc2ccccc2C(=O)c2ccccc2)C(=O)O)cc1 |
| N-(o-Benzoylphenyl)-O-(2-(5-methyl-2-phenyl-4-oxazolyl)ethyl)-L-tyrosine |
| L-Tyrosine,N-(2-benzoylphenyl)-o-(2-(5-methyl-2-phenyl-4-oxazolyl)ethyl) |
| Farglitazar |
| N-(2-benzoylphenyl)-O-[2-(5-methyl-2-phenyl-1,3-oxazol-4-yI)ethyl]-L-tyrosine |
| (2S)-((2-benzoylphenyl)amino)-3-{4-[2-(5-methyl-2-phenyloxazol-4-yl)ethoxy]phenyl}-propionic acid |
| 2-(2-BENZOYL-PHENYLAMINO)-3-{4-[2-(5-METHYL-2-PHENYL-OXAZOL-4-YL)-ETHOXY]-PHENYL}-PROPIONIC ACID |