2-Bromo-3-methyl-indole-1-carboxylic acid tert-butyl ester
Modify Date: 2025-08-27 11:40:19
2-Bromo-3-methyl-indole-1-carboxylic acid tert-butyl ester structure
|
Common Name | 2-Bromo-3-methyl-indole-1-carboxylic acid tert-butyl ester | ||
|---|---|---|---|---|
| CAS Number | 196713-98-1 | Molecular Weight | 310.18600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H16BrNO2 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Symbol |
GHS06, GHS09 |
Signal Word | Danger | |
| Name | 2-Methyl-2-propanyl 2-bromo-3-methyl-1H-indole-1-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H16BrNO2 |
|---|---|
| Molecular Weight | 310.18600 |
| Exact Mass | 309.03600 |
| PSA | 31.23000 |
| LogP | 4.49540 |
| InChIKey | NVJYNNQGUPOOCB-UHFFFAOYSA-N |
| SMILES | Cc1c(Br)n(C(=O)OC(C)(C)C)c2ccccc12 |
| Symbol |
GHS06, GHS09 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H301-H410 |
| Precautionary Statements | P273-P301 + P310-P501 |
| RIDADR | UN2811 - class 6.1 - PG 3 - EHS - Toxic solids, organic, n.o.s., HI: all |
|
~%
2-Bromo-3-methy... CAS#:196713-98-1 |
| Literature: Liu, Ruiyan; Zhang, Puwen; Gan, Tong; Cook, James M. Journal of Organic Chemistry, 1997 , vol. 62, # 21 p. 7447 - 7456 |
|
~%
2-Bromo-3-methy... CAS#:196713-98-1 |
| Literature: Liu, Ruiyan; Zhang, Puwen; Gan, Tong; Cook, James M. Journal of Organic Chemistry, 1997 , vol. 62, # 21 p. 7447 - 7456 |
| 1-(tert-butyloxycarbonyl)-2-bromo-3-methylindole |
| N-Boc-2-bromo-3-methylindole |
| 1-Boc-2-bromoskatole |
| TERT-BUTYL 2,2-DIMETHYLQUINOLINE-1(2H)-CARBOXYLATE |
| 1(2H)-Quinolinecarboxylicacid,2,2-dimethyl-,1,1-dimethylethyl ester |
| 1-tert-butoxycarbonyl-1,2-dihydro-2,2-dimethylquinoline |
| 1-(tert-butyloxycarbonyl)-1,2-dihydro-2,2-dimethylquinoline |