6-METHOXY-7-NITRO-1-INDANONE structure
|
Common Name | 6-METHOXY-7-NITRO-1-INDANONE | ||
|---|---|---|---|---|
| CAS Number | 196597-96-3 | Molecular Weight | 207.18300 | |
| Density | 1.373g/cm3 | Boiling Point | 397.717ºC at 760 mmHg | |
| Molecular Formula | C10H9NO4 | Melting Point | 157-161ºC(lit.) | |
| MSDS | USA | Flash Point | 200.475ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 6-methoxy-7-nitro-2,3-dihydroinden-1-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.373g/cm3 |
|---|---|
| Boiling Point | 397.717ºC at 760 mmHg |
| Melting Point | 157-161ºC(lit.) |
| Molecular Formula | C10H9NO4 |
| Molecular Weight | 207.18300 |
| Flash Point | 200.475ºC |
| Exact Mass | 207.05300 |
| PSA | 72.12000 |
| LogP | 2.25550 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.602 |
| InChIKey | VJEWECISSPCJAV-UHFFFAOYSA-N |
| SMILES | COc1ccc2c(c1[N+](=O)[O-])C(=O)CC2 |
|
~56%
6-METHOXY-7-NIT... CAS#:196597-96-3 |
| Literature: Takeda Chemical Industries, Ltd. Patent: EP1199304 A1, 2002 ; Location in patent: Referential example 44 ; EP 1199304 A1 |
|
~63%
6-METHOXY-7-NIT... CAS#:196597-96-3 |
| Literature: European Journal of Medicinal Chemistry, , vol. 44, # 1 p. 322 - 331 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| 6-Methoxy-7-nitro-1-indanone |