2,3-Dimethyl-4-nitrophenol structure
|
Common Name | 2,3-Dimethyl-4-nitrophenol | ||
|---|---|---|---|---|
| CAS Number | 19499-93-5 | Molecular Weight | 167.162 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 323.9±30.0 °C at 760 mmHg | |
| Molecular Formula | C8H9NO3 | Melting Point | 125ºC | |
| MSDS | N/A | Flash Point | 145.8±13.0 °C | |
| Name | 2,3-dimethyl-4-nitrophenol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 323.9±30.0 °C at 760 mmHg |
| Melting Point | 125ºC |
| Molecular Formula | C8H9NO3 |
| Molecular Weight | 167.162 |
| Flash Point | 145.8±13.0 °C |
| Exact Mass | 167.058243 |
| PSA | 66.05000 |
| LogP | 2.49 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.585 |
| InChIKey | DAEZHJNJHQAEPE-UHFFFAOYSA-N |
| SMILES | Cc1c(O)ccc([N+](=O)[O-])c1C |
| Hazard Codes | Xi |
|---|---|
| Risk Phrases | 20/21/22-36/37/38 |
| Safety Phrases | 26-36/37/39 |
| HS Code | 2908999090 |
| HS Code | 2908999090 |
|---|---|
| Summary | 2908999090 halogenated, sulphonated, nitrated or nitrosated derivatives of phenols or phenol-alcohols。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
| dimethylnitrophenol |
| 2,3-Dimethyl-4-nitrophenol |
| 4-nitro-2,3-dimethylphenol |
| 2,3-dimethyl-4-nitro-phenol |
| 4-Nitro-2,3-xylenol |
| DAEZHJNJHQAEPE-UHFFFAOYSA |
| Phenol, 2,3-dimethyl-4-nitro- |
| Phenol,2,3-dimethyl-4-nitro |
| WNR DQ B1 C1 |