ethyl 2-phenylethylcarbamothioylsulfanylformate
Modify Date: 2024-09-03 17:04:07
ethyl 2-phenylethylcarbamothioylsulfanylformate structure
|
Common Name | ethyl 2-phenylethylcarbamothioylsulfanylformate | ||
|---|---|---|---|---|
| CAS Number | 19457-13-7 | Molecular Weight | 269.38300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H15NO2S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | ethyl 2-phenylethylcarbamothioylsulfanylformate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H15NO2S2 |
|---|---|
| Molecular Weight | 269.38300 |
| Exact Mass | 269.05400 |
| PSA | 102.76000 |
| LogP | 3.40460 |
| Vapour Pressure | 3.92E-06mmHg at 25°C |
| InChIKey | SLDFBVNKAIBTFX-UHFFFAOYSA-N |
| SMILES | CCOC(=O)SC(=S)NCCc1ccccc1 |
| Precursor 0 | |
|---|---|
| DownStream 2 | |
CAS#:2257-09-2
CAS#:91215-17-7| Thiocarbonic acid anhydrosulfide with phenethyldithiocarbamic acid ethyl ester |
| Carbonic acid,thio-,anhydrosulfide with phenethyldithiocarbamic acid,ethyl ester |
| ethyl phenethylcarbamothioylsulfanylformate |