2,6-bis(1-piperidyl)-5H-purine structure
|
Common Name | 2,6-bis(1-piperidyl)-5H-purine | ||
|---|---|---|---|---|
| CAS Number | 1928-79-6 | Molecular Weight | 286.37500 | |
| Density | 1.42g/cm3 | Boiling Point | 421.4ºC at 760 mmHg | |
| Molecular Formula | C15H22N6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 208.6ºC | |
| Name | 2,6-di(piperidin-1-yl)-7H-purine |
|---|
| Density | 1.42g/cm3 |
|---|---|
| Boiling Point | 421.4ºC at 760 mmHg |
| Molecular Formula | C15H22N6 |
| Molecular Weight | 286.37500 |
| Flash Point | 208.6ºC |
| Exact Mass | 286.19100 |
| PSA | 60.94000 |
| LogP | 2.46350 |
| Vapour Pressure | 2.62E-07mmHg at 25°C |
| Index of Refraction | 1.749 |
| InChIKey | CXXUKBNUHXUAKA-UHFFFAOYSA-N |
| SMILES | c1nc2nc(N3CCCCC3)nc(N3CCCCC3)c2[nH]1 |
|
~%
2,6-bis(1-piper... CAS#:1928-79-6 |
| Literature: Breshears et al. Journal of the American Chemical Society, 1959 , vol. 81, p. 3789,3790 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |