Methyl (2,4,5-trichlorophenoxy)acetate structure
|
Common Name | Methyl (2,4,5-trichlorophenoxy)acetate | ||
|---|---|---|---|---|
| CAS Number | 1928-37-6 | Molecular Weight | 269.509 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 329.5±37.0 °C at 760 mmHg | |
| Molecular Formula | C9H7Cl3O3 | Melting Point | 90.08°C | |
| MSDS | Chinese USA | Flash Point | 136.6±25.5 °C | |
| Symbol |
GHS07, GHS09 |
Signal Word | Warning | |
| Name | 2,4,5-T-methyl |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 329.5±37.0 °C at 760 mmHg |
| Melting Point | 90.08°C |
| Molecular Formula | C9H7Cl3O3 |
| Molecular Weight | 269.509 |
| Flash Point | 136.6±25.5 °C |
| Exact Mass | 267.946075 |
| PSA | 35.53000 |
| LogP | 3.28 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.544 |
| InChIKey | JUCNGUOYQGHBJC-UHFFFAOYSA-N |
| SMILES | COC(=O)COc1cc(Cl)c(Cl)cc1Cl |
| Storage condition | 2-8°C |
| Symbol |
GHS07, GHS09 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302-H315-H319-H335-H410 |
| Precautionary Statements | P261-P273-P305 + P351 + P338-P501 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | F,Xn,N |
| Risk Phrases | 11-38-48/20-51/53-62-65-67-50/53-36/37/38-22 |
| Safety Phrases | 36/37-61-62-60-24 |
| RIDADR | UN 3345 |
| Packaging Group | III |
| Hazard Class | 6.1(b) |
| HS Code | 2918990090 |
|
~99%
Methyl (2,4,5-t... CAS#:1928-37-6 |
| Literature: Chatfield; Croft; Dang; Murby; Yu; Wells Analytical Chemistry, 1995 , vol. 67, # 5 p. 945 - 951 |
|
~%
Methyl (2,4,5-t... CAS#:1928-37-6 |
| Literature: Collection of Czechoslovak Chemical Communications, , vol. 48, # 4 p. 1089 - 1096 |
|
~%
Methyl (2,4,5-t... CAS#:1928-37-6 |
| Literature: Collection of Czechoslovak Chemical Communications, , vol. 48, # 4 p. 1089 - 1096 |
| Precursor 4 | |
|---|---|
| DownStream 5 | |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|
Mesenchymal stem cells derived from human gingiva are capable of immunomodulatory functions and ameliorate inflammation-related tissue destruction in experimental colitis.
J. Immunol. 183(12) , 7787-98, (2009) Aside from the well-established self-renewal and multipotent differentiation properties, mesenchymal stem cells exhibit both immunomodulatory and anti-inflammatory roles in several experimental autoim... |
| methyl 2-(2,4,5-trichlorophenoxy)acetate |
| Methyl-2,4,5-trichlorphenoxyacetat |
| MFCD00055247 |
| ACETIC ACID, (2,4,5-TRICHLOROPHENOXY)-, METHYL ESTER |
| 2,5-T Methyl ester |
| 2,4,5-T Methyl ester |
| Acetic acid, 2-(2,4,5-trichlorophenoxy)-, methyl ester |
| 2,4,5-Trichlorophenoxyacetic acid methyl ester |
| Methyl (2,4,5-trichlorophenoxy)acetate |