FITC-Tyr-Val-Ala-Asp-Ala-Pro-Lys(Dnp)-OH (Contains FITC isomer I) structure
|
Common Name | FITC-Tyr-Val-Ala-Asp-Ala-Pro-Lys(Dnp)-OH (Contains FITC isomer I) | ||
|---|---|---|---|---|
| CAS Number | 1926163-32-7 | Molecular Weight | 1318.322 | |
| Density | 1.6±0.1 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C62H67N11O20S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of FITC-Tyr-Val-Ala-Asp-Ala-Pro-Lys(Dnp)-OH (Contains FITC isomer I)FITC-YVADAPK(Dnp) is a fluorogenic substrate[1]. |
| Name | FITC-Tyr-Val-Ala-Asp-Ala-Pro-Lys(Dnp)-OH (Contains FITC isomer I) |
|---|---|
| Synonym | More Synonyms |
| Description | FITC-YVADAPK(Dnp) is a fluorogenic substrate[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Molecular Formula | C62H67N11O20S |
| Molecular Weight | 1318.322 |
| Exact Mass | 1317.428467 |
| LogP | 5.61 |
| Index of Refraction | 1.717 |
| InChIKey | CSHXTBYHFOGNFN-GBZKBENMSA-N |
| SMILES | CC(NC(=O)C(NC(=O)C(Cc1ccc(O)cc1)NC(=S)Nc1ccc2c(c1)C1(OC2=O)c2ccc(O)cc2Oc2cc(O)ccc21)C(C)C)C(=O)NC(CC(=O)O)C(=O)NC(C)C(=O)N1CCCC1C(=O)NC(CCCCNc1ccc([N+](=O)[O-])cc1[N+](=O)[O-])C(=O)O |
| N-[(3',6'-Dihydroxy-3-oxo-3H-spiro[2-benzofuran-1,9'-xanthen]-6-yl)carbamothioyl]-L-tyrosyl-L-valyl-L-alanyl-L-α-aspartyl-L-alanyl-L-prolyl-N6-(2,4-dinitrophenyl)-L-lysine |
| L-Lysine, N-[[(3',6'-dihydroxy-3-oxospiro[isobenzofuran-1(3H),9'-[9H]xanthen]-6-yl)amino]thioxomethyl]-L-tyrosyl-L-valyl-L-alanyl-L-α-aspartyl-L-alanyl-L-prolyl-N6-(2,4-dinitrophenyl)- |