Lactyl-CoA structure
|
Common Name | Lactyl-CoA | ||
|---|---|---|---|---|
| CAS Number | 1926-57-4 | Molecular Weight | 839.59700 | |
| Density | 1.91g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C24H40N7O18P3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Lactyl-CoALactyl-CoA is an acyl-CoA formally condensed from the sulfhydryl group of CoA and the carboxyl group of lactic acid, also known as lactyl-CoA. Lactyl-CoA is essential for the biosynthesis of biodegradable and biocompatible lactic acid-based copolymers[1]. |
| Name | lactoyl-CoA |
|---|---|
| Synonym | More Synonyms |
| Description | Lactyl-CoA is an acyl-CoA formally condensed from the sulfhydryl group of CoA and the carboxyl group of lactic acid, also known as lactyl-CoA. Lactyl-CoA is essential for the biosynthesis of biodegradable and biocompatible lactic acid-based copolymers[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.91g/cm3 |
|---|---|
| Molecular Formula | C24H40N7O18P3S |
| Molecular Weight | 839.59700 |
| Exact Mass | 839.13600 |
| PSA | 445.57000 |
| LogP | 0.30730 |
| Index of Refraction | 1.719 |
| InChIKey | VIWKEBOLLIEAIL-FBMOWMAESA-N |
| SMILES | CC(O)C(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(O)OP(=O)(O)OCC1OC(n2cnc3c(N)ncnc32)C(O)C1OP(=O)(O)O |
|
~%
Lactyl-CoA CAS#:1926-57-4 |
| Literature: Vagelos et al. Journal of Biological Chemistry, 1959 , vol. 234, p. 765,766 |
| Lactoyl-coenzyme A |
| S-[2-[3-[[(2R)-4-[[[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-4-hydroxy-3-phosphonooxyoxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-hydroxyphosphoryl]oxy-2-hydroxy-3,3-dimethylbutanoyl]amino]propanoylamino]ethyl] 2-hydroxypropanethioate |
| Lactyl-coa |
| Coenzyme A,lactoyl |
| 2-hydroxypropionyl CoA |
| S-(2-hydroxypropanoate |
| Lactoyl-CoA |
| 2-hydroxypropanoyl CoA |