Trichloroacetylphosphonic acid diethyl ester
Modify Date: 2025-10-20 17:14:18
Trichloroacetylphosphonic acid diethyl ester structure
|
Common Name | Trichloroacetylphosphonic acid diethyl ester | ||
|---|---|---|---|---|
| CAS Number | 19239-52-2 | Molecular Weight | 283.47400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C6H10Cl3O4P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2,2,2-trichloro-1-diethoxyphosphorylethanone |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C6H10Cl3O4P |
|---|---|
| Molecular Weight | 283.47400 |
| Exact Mass | 281.93800 |
| PSA | 62.41000 |
| LogP | 3.14930 |
| Vapour Pressure | 0.0142mmHg at 25°C |
| InChIKey | WDXGHPAMAUOFPM-UHFFFAOYSA-N |
| SMILES | CCOP(=O)(OCC)C(=O)C(Cl)(Cl)Cl |
| HS Code | 2931900090 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 1 | |
CAS#:19285-67-7| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| Phosphonic acid,trichloroacetyl-,diethyl ester |
| Diethyl (1-oxo-2,2,2-trichloro)ethylphosphonate |
| Trichloroacetylphosphonic acid diethyl ester |
| diethyl(trichloroacetyl)phosphonate |