Benzoylmalonic acid diethyl ester structure
|
Common Name | Benzoylmalonic acid diethyl ester | ||
|---|---|---|---|---|
| CAS Number | 1087-97-4 | Molecular Weight | 264.27400 | |
| Density | 1,15 g/cm3 | Boiling Point | 195°C 14mm | |
| Molecular Formula | C14H16O5 | Melting Point | 166ºC | |
| MSDS | N/A | Flash Point | 142.3ºC | |
| Name | diethyl 2-benzoylpropanedioate |
|---|---|
| Synonym | More Synonyms |
| Density | 1,15 g/cm3 |
|---|---|
| Boiling Point | 195°C 14mm |
| Melting Point | 166ºC |
| Molecular Formula | C14H16O5 |
| Molecular Weight | 264.27400 |
| Flash Point | 142.3ºC |
| Exact Mass | 264.10000 |
| PSA | 69.67000 |
| LogP | 1.61170 |
| Vapour Pressure | 0.00016mmHg at 25°C |
| Index of Refraction | 1.506 |
| InChIKey | RIQBATDJIKIMBM-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(C(=O)OCC)C(=O)c1ccccc1 |
| Risk Phrases | R36/37/38:Irritating to eyes, respiratory system and skin . |
|---|---|
| Safety Phrases | S26-S36/37/39 |
| HS Code | 2918300090 |
| Precursor 9 | |
|---|---|
| DownStream 10 | |
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| Diethyl 2-benzoylmalonate |
| Diethyl BenzoylMalonate |
| benzoyl-malonic acid diethyl ester |
| Benzoylmalonic Acid Diethyl Ester |
| Benzoyl-malonsaeure-diaethylester |
| diethylbenzoylmalonate |
| MFCD00059381 |
| Propanedioic acid,benzoyl-,diethyl ester |