2-Bromo-1-chloro-3-nitrobenzene structure
|
Common Name | 2-Bromo-1-chloro-3-nitrobenzene | ||
|---|---|---|---|---|
| CAS Number | 19128-48-4 | Molecular Weight | 236.451 | |
| Density | 1.8±0.1 g/cm3 | Boiling Point | 252.7±20.0 °C at 760 mmHg | |
| Molecular Formula | C6H3BrClNO2 | Melting Point | 83-85℃ | |
| MSDS | N/A | Flash Point | 106.6±21.8 °C | |
| Name | 2-Bromo-1-chloro-3-nitrobenzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.8±0.1 g/cm3 |
|---|---|
| Boiling Point | 252.7±20.0 °C at 760 mmHg |
| Melting Point | 83-85℃ |
| Molecular Formula | C6H3BrClNO2 |
| Molecular Weight | 236.451 |
| Flash Point | 106.6±21.8 °C |
| Exact Mass | 234.903564 |
| PSA | 45.82000 |
| LogP | 3.12 |
| Vapour Pressure | 0.0±0.5 mmHg at 25°C |
| Index of Refraction | 1.619 |
| InChIKey | UYTRBIUOIKOGQO-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cccc(Cl)c1Br |
| Hazard Codes | T+ |
|---|---|
| RIDADR | 2811 |
| Packaging Group | Ⅲ |
| HS Code | 2904909090 |
|
~13%
2-Bromo-1-chlor... CAS#:19128-48-4 |
| Literature: Journal of Organic Chemistry, , vol. 76, # 9 p. 3416 - 3437 |
|
~%
2-Bromo-1-chlor... CAS#:19128-48-4 |
| Literature: Acta Chemica Scandinavica (1947-1973), , vol. 21, p. 2679 - 2688 |
|
~%
2-Bromo-1-chlor... CAS#:19128-48-4 |
| Literature: Acta Chemica Scandinavica (1947-1973), , vol. 21, p. 2679 - 2688 |
| HS Code | 2904909090 |
|---|---|
| Summary | HS:2904909090 sulphonated, nitrated or nitrosated derivatives of hydrocarbons, whether or not halogenated VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| Benzene, 2-bromo-1-chloro-3-nitro- |
| 2-Brom-3-chlor-nitro-benzol |
| 2-bromo-3-chloro-1-nitrobenzene |
| 2-Bromo-1-chloro-3-nitrobenzene |
| 2-bromo-3-chloro-4-nitrobenzene |
| 2-Bromo-3-chloro-nitrobenzol |
| 2-BROMO-3-CHLORONITROBENZENE |
| CL8232 |