Anserinone B
Modify Date: 2025-09-20 21:18:50
Anserinone B structure
|
Common Name | Anserinone B | ||
|---|---|---|---|---|
| CAS Number | 190895-96-6 | Molecular Weight | 210.23 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H14O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Anserinone BAnserinone B is an antifungal and antibacterial benzoquinone. Anserinone B causes radial growth reductions of 50% and 37% against S.fimicola and A. furfuraceus, respectively. Anserinones B also displays moderate cytotoxicity in the NCI’s 60 human tumor cell line panel (GI50=4.4 µg/mL)[1]. |
| Name | Anserinone B |
|---|
| Description | Anserinone B is an antifungal and antibacterial benzoquinone. Anserinone B causes radial growth reductions of 50% and 37% against S.fimicola and A. furfuraceus, respectively. Anserinones B also displays moderate cytotoxicity in the NCI’s 60 human tumor cell line panel (GI50=4.4 µg/mL)[1]. |
|---|---|
| Related Catalog | |
| Target |
Microbial Metabolite |
| Molecular Formula | C11H14O4 |
|---|---|
| Molecular Weight | 210.23 |
| InChIKey | UDHYZSNFKHIRSC-ZCFIWIBFSA-N |
| SMILES | COC1=CC(=O)C(C)=C(CC(C)O)C1=O |