Danshenol B
Modify Date: 2025-11-28 18:17:50
Danshenol B structure
|
Common Name | Danshenol B | ||
|---|---|---|---|---|
| CAS Number | 189308-09-6 | Molecular Weight | 354.43900 | |
| Density | 1.24±0.1 g/cm3 | Boiling Point | 501.3±50.0 °C at 760 mmHg | |
| Molecular Formula | C22H26O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Danshenol BDanshenol B is a diterpenoid. Danshenol B has strong aldose reductase (AR) inhibitory activity with IC50 value of 0.042μM. Danshenol B can be used for the research of diabetic related complication resulted by metabolic abnormality, such as cataracts, retinopathy, neuropathy, and nephropathy[1]. |
| Name | (1R,10S)-10-hydroxy-1,6,6-trimethyl-10-(2-oxopropyl)-2,7,8,9-tetrahydro-1H-naphtho[1,2-g][1]benzofuran-11-one |
|---|---|
| Synonym | More Synonyms |
| Description | Danshenol B is a diterpenoid. Danshenol B has strong aldose reductase (AR) inhibitory activity with IC50 value of 0.042μM. Danshenol B can be used for the research of diabetic related complication resulted by metabolic abnormality, such as cataracts, retinopathy, neuropathy, and nephropathy[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.24±0.1 g/cm3 |
|---|---|
| Boiling Point | 501.3±50.0 °C at 760 mmHg |
| Molecular Formula | C22H26O4 |
| Molecular Weight | 354.43900 |
| Exact Mass | 354.18300 |
| PSA | 63.60000 |
| LogP | 3.42730 |
| Vapour Pressure | 7.19E-11mmHg at 25°C |
| InChIKey | KZLPKGGMSDHTRS-YTEVENLXSA-N |
| SMILES | CC(=O)CC1(O)C(=O)C2=C(OCC2C)c2ccc3c(c21)CCCC3(C)C |
| Phenanthro(1,2-b)furan-11(2H)-one,1,6,7,8,9,10-hexahydro-10-hydroxy-1,6,6-trimethyl-10-(2-oxopropyl)-,(1R-trans) |
| Phenanthro(1,2-b)furan-11(2H)-one,1,6,7,8,9,10-hexahydro-10-hydroxy-1,6,6-trimethyl-10-(2-oxopropyl)-,(1R,10S) |
| Danshenol B |