Corynantheine structure
|
Common Name | Corynantheine | ||
|---|---|---|---|---|
| CAS Number | 18904-54-6 | Molecular Weight | 366.45 | |
| Density | 1.22g/cm3 | Boiling Point | 533.2ºC at 760mmHg | |
| Molecular Formula | C22H26N2O3 | Melting Point | 103-107° | |
| MSDS | N/A | Flash Point | 276.3ºC | |
Use of CorynantheineCorynantheine is a natural product that can be isolated from Pseudocinchona africana A. Chev.[1]. |
| Name | methyl (Z)-2-[(2S,3R,12bS)-3-ethenyl-1,2,3,4,6,7,12,12b-octahydroindolo[2,3-a]quinolizin-2-yl]-3-methoxyprop-2-enoate |
|---|---|
| Synonym | More Synonyms |
| Description | Corynantheine is a natural product that can be isolated from Pseudocinchona africana A. Chev.[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.22g/cm3 |
|---|---|
| Boiling Point | 533.2ºC at 760mmHg |
| Melting Point | 103-107° |
| Molecular Formula | C22H26N2O3 |
| Molecular Weight | 366.45 |
| Flash Point | 276.3ºC |
| Exact Mass | 366.19400 |
| PSA | 54.56000 |
| LogP | 3.53040 |
| Vapour Pressure | 1.89E-11mmHg at 25°C |
| Index of Refraction | 1.623 |
| InChIKey | TZUGIFAYWNNSAO-XPOGPMDLSA-N |
| SMILES | C=CC1CN2CCc3c([nH]c4ccccc34)C2CC1C(=COC)C(=O)OC |
| 17-methoxy-coryna-16,18-diene-16-carboxylic acid methyl ester |
| Corynantheine |
| Hirsuteine |