IDO-IN-9 structure
|
Common Name | IDO-IN-9 | ||
|---|---|---|---|---|
| CAS Number | 1888378-12-8 | Molecular Weight | 446.25 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H13BrFN7O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of IDO-IN-9IDO-IN-9 is an indoleamine-2,3-dioxygenase (IDO) inhibitor with IC50s of 0.011 μM (Kinase) and 0.0018 μM (Hela Cell), extracted from patent WO 2016041489 A1, compound 6. |
| Name | IDO-IN-9 |
|---|
| Description | IDO-IN-9 is an indoleamine-2,3-dioxygenase (IDO) inhibitor with IC50s of 0.011 μM (Kinase) and 0.0018 μM (Hela Cell), extracted from patent WO 2016041489 A1, compound 6. |
|---|---|
| Related Catalog | |
| Target |
IDO:11 nM (IC50) IDO:1.8 nM (IC50, in Hela cell) |
| References |
| Molecular Formula | C13H13BrFN7O3S |
|---|---|
| Molecular Weight | 446.25 |
| InChIKey | GGHPYZYCOWLIBW-UHFFFAOYSA-N |
| SMILES | CS(=O)(CCNc1nonc1C(=Nc1ccc(F)c(Br)c1)NO)=NC#N |
| Storage condition | 2-8℃ |