2,4-bis(Trifluoromethyl)-5-pyrimidinecarboxylic acid ethyl ester structure
|
Common Name | 2,4-bis(Trifluoromethyl)-5-pyrimidinecarboxylic acid ethyl ester | ||
|---|---|---|---|---|
| CAS Number | 188781-15-9 | Molecular Weight | 288.14700 | |
| Density | 1.46g/cm3 | Boiling Point | 227.1ºC at 760mmHg | |
| Molecular Formula | C9H6F6N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 91.2ºC | |
| Name | ethyl 2,4-bis(trifluoromethyl)pyrimidine-5-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.46g/cm3 |
|---|---|
| Boiling Point | 227.1ºC at 760mmHg |
| Molecular Formula | C9H6F6N2O2 |
| Molecular Weight | 288.14700 |
| Flash Point | 91.2ºC |
| Exact Mass | 288.03300 |
| PSA | 52.08000 |
| LogP | 2.69090 |
| Vapour Pressure | 0.079mmHg at 25°C |
| Index of Refraction | 1.409 |
| InChIKey | SRFVAGSJHJMMME-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1cnc(C(F)(F)F)nc1C(F)(F)F |
|
~40%
2,4-bis(Trifluo... CAS#:188781-15-9 |
| Literature: Palanki; Erdman; Gayo-Fung; Shevlin; Sullivan; Goldman; Ransone; Bennett; Manning; Suto Journal of medicinal chemistry, 2000 , vol. 43, # 21 p. 3995 - 4004 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Ethyl 2,4-bis(trifluoromethyl)pyrimidine-5-carboxylate |