Diazo Biotin-PEG3-alkyne
Modify Date: 2025-09-13 00:50:49
Diazo Biotin-PEG3-alkyne structure
|
Common Name | Diazo Biotin-PEG3-alkyne | ||
|---|---|---|---|---|
| CAS Number | 1884349-58-9 | Molecular Weight | 795.94 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C39H53N7O9S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Diazo Biotin-PEG3-alkyneDiazo Biotin-PEG3-alkyne is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
| Name | Diazo Biotin-PEG3-alkyne |
|---|---|
| Synonym | More Synonyms |
| Description | Diazo Biotin-PEG3-alkyne is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
|---|---|
| Related Catalog | |
| Target |
PEGs |
| In Vitro | PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins[1]. |
| References |
| Molecular Formula | C39H53N7O9S |
|---|---|
| Molecular Weight | 795.94 |
| InChIKey | AIUZFZDETVBCLH-OHTDSXDOSA-N |
| SMILES | C#CCOCCC(=O)NCCc1ccc(O)c(N=Nc2ccc(C(=O)NCCOCCOCCOCCNC(=O)CCCCC3SCC4NC(=O)NC43)cc2)c1 |
| MFCD28505544 |