boscalid structure
|
Common Name | boscalid | ||
|---|---|---|---|---|
| CAS Number | 188425-85-6 | Molecular Weight | 343.21 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 557.0±60.0 °C at 760 mmHg | |
| Molecular Formula | C18H12Cl2N2O | Melting Point | 142.8 to 143.8ºC | |
| MSDS | USA | Flash Point | 290.7±32.9 °C | |
| Symbol |
GHS09 |
Signal Word | ||
Use of boscalidBoscalid is an anti-fungal agent. Boscalid is a succinate dehydrogenase (SDH) inhibitor[1]. |
| Name | boscalid |
|---|---|
| Synonym | More Synonyms |
| Description | Boscalid is an anti-fungal agent. Boscalid is a succinate dehydrogenase (SDH) inhibitor[1]. |
|---|---|
| Related Catalog | |
| Target |
succinate dehydrogenase (SDH)[1] |
| References |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 557.0±60.0 °C at 760 mmHg |
| Melting Point | 142.8 to 143.8ºC |
| Molecular Formula | C18H12Cl2N2O |
| Molecular Weight | 343.21 |
| Flash Point | 290.7±32.9 °C |
| Exact Mass | 342.032654 |
| PSA | 41.99000 |
| LogP | 5.72 |
| Vapour Pressure | 0.0±1.6 mmHg at 25°C |
| Index of Refraction | 1.636 |
| InChIKey | WYEMLYFITZORAB-UHFFFAOYSA-N |
| SMILES | O=C(Nc1ccccc1-c1ccc(Cl)cc1)c1cccnc1Cl |
| Storage condition | 0-6°C |
| Precursor 9 | |
|---|---|
| DownStream 0 | |
|
Acaricide, fungicide and drug interactions in honey bees (Apis mellifera).
PLoS ONE 8(1) , e54092, (2013) Chemical analysis shows that honey bees (Apis mellifera) and hive products contain many pesticides derived from various sources. The most abundant pesticides are acaricides applied by beekeepers to co... |
| 2-Chloro-N-(4'-chloro[1,1'-biphenyl]-2-yl)-3-pyridinecarboxamide |
| boscalid |
| 2-chloro-N-[2-(4-chlorophenyl)phenyl]pyridine-3-carboxamide |
| 2-Chloro-N-(4'-chloro-2-biphenylyl)nicotinamide |
| 2-chloro-N-(4’-chloro[1,1’-biphenyl]-2-yl)-3-pyridinecarboxamide |
| 2-Chloro-N-(4'-chloro-2-biphenylyl)-3-pyridinecarboximidic acid |
| Endura |
| 2-chloro-N-(4’-chloro[1,1’-biphenyl]-2-yl)pyridine-3-carboxamide |
| Emerald |
| 3-Pyridinecarboxamide, 2-chloro-N-(4'-chloro[1,1'-biphenyl]-2-yl)- |
| 2-chloro-N-(4’-chlorobiphenyl-2-yl)nicotinamide |
| T6NJ BG CVMR BR DG |
| UNII-32MS8ZRD1V |
| Cantus |
| BAS 510F |
| Nicobifen |