ASN90
Modify Date: 2025-08-26 06:54:16
ASN90 structure
|
Common Name | ASN90 | ||
|---|---|---|---|---|
| CAS Number | 1884154-02-2 | Molecular Weight | 375.45 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H21N5O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of ASN90ASN90 is a specific and orally active O-GlcNAcase (OGA) enzyme inhibitor with IC50 value of 10.2 nM. ASN90 can be used for the research of neurodegenerative diseases, such as tauopathies and α-synucleinopathies[1]. |
| Name | ASN90 |
|---|
| Description | ASN90 is a specific and orally active O-GlcNAcase (OGA) enzyme inhibitor with IC50 value of 10.2 nM. ASN90 can be used for the research of neurodegenerative diseases, such as tauopathies and α-synucleinopathies[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C17H21N5O3S |
|---|---|
| Molecular Weight | 375.45 |
| InChIKey | PLUUAFJXXNCXSD-NSHDSACASA-N |
| SMILES | CC(=O)Nc1nnc(N2CCN(C(C)c3ccc4c(c3)OCO4)CC2)s1 |