massonianoside b
Modify Date: 2025-08-22 18:03:44
massonianoside b structure
|
Common Name | massonianoside b | ||
|---|---|---|---|---|
| CAS Number | 188300-19-8 | Molecular Weight | 492.52 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 708.9±60.0 °C at 760 mmHg | |
| Molecular Formula | C25H32O10 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 382.6±32.9 °C | |
Use of massonianoside bMassonianoside B is an antioxidant, which can be isolated from Cedrus deodara pine needle. Massonianoside B exhibits radicals scavenging capacities, and restores CCL4-impaired activity of antioxidant enzymes[1]. |
| Name | 4-[(2S,3R)-7-Hydroxy-3-(hydroxymethyl)-5-(3-hydroxypropyl)-2,3-di hydro-1-benzofuran-2-yl]-2-methoxyphenyl 6-deoxy-α-L-mannopyranos ide |
|---|---|
| Synonym | More Synonyms |
| Description | Massonianoside B is an antioxidant, which can be isolated from Cedrus deodara pine needle. Massonianoside B exhibits radicals scavenging capacities, and restores CCL4-impaired activity of antioxidant enzymes[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 708.9±60.0 °C at 760 mmHg |
| Molecular Formula | C25H32O10 |
| Molecular Weight | 492.52 |
| Flash Point | 382.6±32.9 °C |
| Exact Mass | 492.199554 |
| PSA | 158.30000 |
| LogP | 0.83 |
| Vapour Pressure | 0.0±2.4 mmHg at 25°C |
| Index of Refraction | 1.630 |
| InChIKey | PHHIEOZUONPPQY-ROQFLNLZSA-N |
| SMILES | COc1cc(C2Oc3c(O)cc(CCCO)cc3C2CO)ccc1OC1OC(C)C(O)C(O)C1O |
| Hazard Codes | Xi |
|---|
| 4-[(2S,3R)-7-Hydroxy-3-(hydroxymethyl)-5-(3-hydroxypropyl)-2,3-dihydro-1-benzofuran-2-yl]-2-methoxyphenyl 6-deoxy-α-L-mannopyranoside |
| α-L-Mannopyranoside, 4-[(2S,3R)-2,3-dihydro-7-hydroxy-3-(hydroxymethyl)-5-(3-hydroxypropyl)-2-benzofuranyl]-2-methoxyphenyl 6-deoxy- |