triphenyl-thiophen-2-yl-silane structure
|
Common Name | triphenyl-thiophen-2-yl-silane | ||
|---|---|---|---|---|
| CAS Number | 18740-94-8 | Molecular Weight | 342.52900 | |
| Density | 1.15g/cm3 | Boiling Point | 433.3ºC at 760 mmHg | |
| Molecular Formula | C22H18SSi | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 215.8ºC | |
| Name | triphenyl(thiophen-2-yl)silane |
|---|---|
| Synonym | More Synonyms |
| Density | 1.15g/cm3 |
|---|---|
| Boiling Point | 433.3ºC at 760 mmHg |
| Molecular Formula | C22H18SSi |
| Molecular Weight | 342.52900 |
| Flash Point | 215.8ºC |
| Exact Mass | 342.09000 |
| PSA | 28.24000 |
| LogP | 3.12550 |
| Vapour Pressure | 2.63E-07mmHg at 25°C |
| Index of Refraction | 1.65 |
| InChIKey | WSFTWAORPPESCI-UHFFFAOYSA-N |
| SMILES | c1ccc([Si](c2ccccc2)(c2ccccc2)c2cccs2)cc1 |
|
~62%
triphenyl-thiop... CAS#:18740-94-8 |
| Literature: Gmelin Handbook: Si: MVol.C, 30, page 94 - 96 |
|
~%
triphenyl-thiop... CAS#:18740-94-8 |
| Literature: Gilman et al. Journal of the American Chemical Society, 1950 , vol. 72, p. 1689 |
| triphenyl-thiophen-2-yl-silane |