1,3,5-TRIAZINE-2,4-DIAMINE, 6-[4-(TRIFLUOROMETHYL)PHENYL]- structure
|
Common Name | 1,3,5-TRIAZINE-2,4-DIAMINE, 6-[4-(TRIFLUOROMETHYL)PHENYL]- | ||
|---|---|---|---|---|
| CAS Number | 186834-97-9 | Molecular Weight | 255.19900 | |
| Density | 1.479g/cm3 | Boiling Point | 467.8ºC at 760mmHg | |
| Molecular Formula | C10H8F3N5 | Melting Point | 239-241ºC(lit.) | |
| MSDS | N/A | Flash Point | 236.7ºC | |
| Name | 6-[4-(trifluoromethyl)phenyl]-1,3,5-triazine-2,4-diamine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.479g/cm3 |
|---|---|
| Boiling Point | 467.8ºC at 760mmHg |
| Melting Point | 239-241ºC(lit.) |
| Molecular Formula | C10H8F3N5 |
| Molecular Weight | 255.19900 |
| Flash Point | 236.7ºC |
| Exact Mass | 255.07300 |
| PSA | 90.71000 |
| LogP | 2.88420 |
| Vapour Pressure | 6.31E-09mmHg at 25°C |
| Index of Refraction | 1.594 |
| InChIKey | BJDQOYKKFRUFII-UHFFFAOYSA-N |
| SMILES | Nc1nc(N)nc(-c2ccc(C(F)(F)F)cc2)n1 |
| Hazard Codes | T: Toxic;Xi: Irritant; |
|---|---|
| Risk Phrases | R25 |
| Safety Phrases | S26 |
| RIDADR | UN 2811 6.1/PG 2 |
| HS Code | 2933699090 |
| HS Code | 2933699090 |
|---|---|
| Summary | 2933699090 other compounds containing an unfused triazine ring (whether or not hydrogenated) in the structure。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:20.0% |
| 2,3-dioxoindoline-7-carboxylic acid |
| pc6644 |
| MFCD00268940 |