5-Formyl-2-[(2-nitrophenyl)amino]-3-cyanothiophene structure
|
Common Name | 5-Formyl-2-[(2-nitrophenyl)amino]-3-cyanothiophene | ||
|---|---|---|---|---|
| CAS Number | 186792-87-0 | Molecular Weight | 273.26700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H7N3O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-formyl-2-(2-nitroanilino)thiophene-3-carbonitrile |
|---|
| Molecular Formula | C12H7N3O3S |
|---|---|
| Molecular Weight | 273.26700 |
| Exact Mass | 273.02100 |
| PSA | 126.95000 |
| LogP | 3.68028 |
| InChIKey | CQNFCAMNWVNZNM-UHFFFAOYSA-N |
| SMILES | N#Cc1cc(C=O)sc1Nc1ccccc1[N+](=O)[O-] |
|
~%
5-Formyl-2-[(2-... CAS#:186792-87-0 |
| Literature: Bioorganic and Medicinal Chemistry Letters, , vol. 7, # 1 p. 25 - 30 |
|
~%
5-Formyl-2-[(2-... CAS#:186792-87-0 |
| Literature: Bioorganic and Medicinal Chemistry Letters, , vol. 7, # 1 p. 25 - 30 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |