2-Thiazolamine,5-[2-(2-nitrophenyl)diazenyl]-4-phenyl- structure
|
Common Name | 2-Thiazolamine,5-[2-(2-nitrophenyl)diazenyl]-4-phenyl- | ||
|---|---|---|---|---|
| CAS Number | 26179-17-9 | Molecular Weight | 325.34500 | |
| Density | 1.48g/cm3 | Boiling Point | 476.3ºC at 760mmHg | |
| Molecular Formula | C15H11N5O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 241.9ºC | |
| Name | N-[(E)-(2-imino-4-phenyl-1,3-thiazol-5-ylidene)amino]-2-nitroaniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.48g/cm3 |
|---|---|
| Boiling Point | 476.3ºC at 760mmHg |
| Molecular Formula | C15H11N5O2S |
| Molecular Weight | 325.34500 |
| Flash Point | 241.9ºC |
| Exact Mass | 325.06300 |
| PSA | 137.69000 |
| LogP | 5.82030 |
| Vapour Pressure | 3.08E-09mmHg at 25°C |
| Index of Refraction | 1.741 |
| InChIKey | SRFKIOKZMWADHD-UHFFFAOYSA-N |
| SMILES | Nc1nc(-c2ccccc2)c(N=Nc2ccccc2[N+](=O)[O-])s1 |
|
~%
2-Thiazolamine,... CAS#:26179-17-9 |
| Literature: Garg; Sharma Journal of pharmaceutical sciences, 1970 , vol. 59, # 3 p. 348 - 353 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| 5-(2-nitro-phenylazo)-4-phenyl-thiazol-2-ylamine |