1,2,4-Benzotriazin-3-amine,7-chloro-, 1-oxide
Modify Date: 2025-08-23 13:47:23
1,2,4-Benzotriazin-3-amine,7-chloro-, 1-oxide structure
|
Common Name | 1,2,4-Benzotriazin-3-amine,7-chloro-, 1-oxide | ||
|---|---|---|---|---|
| CAS Number | 18671-92-6 | Molecular Weight | 196.59400 | |
| Density | 1.77g/cm3 | Boiling Point | 426.7ºC at 760mmHg | |
| Molecular Formula | C7H5ClN4O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 211.9ºC | |
| Name | 7-chloro-1-oxido-1,2,4-benzotriazin-1-ium-3-amine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.77g/cm3 |
|---|---|
| Boiling Point | 426.7ºC at 760mmHg |
| Molecular Formula | C7H5ClN4O |
| Molecular Weight | 196.59400 |
| Flash Point | 211.9ºC |
| Exact Mass | 196.01500 |
| PSA | 77.26000 |
| LogP | 1.87510 |
| Vapour Pressure | 9.86E-09mmHg at 25°C |
| Index of Refraction | 1.785 |
| InChIKey | OXILOAZZXVNKSG-UHFFFAOYSA-N |
| SMILES | Nc1nc2ccc(Cl)cc2[n+]([O-])n1 |
| HS Code | 2933699090 |
|---|
| HS Code | 2933699090 |
|---|---|
| Summary | 2933699090 other compounds containing an unfused triazine ring (whether or not hydrogenated) in the structure。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:20.0% |
| 3-AMINO-7-CHLORO-1,2,4-BENZOTRIAZINE-1-OXIDE |
| 7-chloro-1,2,4-benzotriazin-3-amine 1-oxide |