4-bromo-3'-nitroacetophenone structure
|
Common Name | 4-bromo-3'-nitroacetophenone | ||
|---|---|---|---|---|
| CAS Number | 18640-58-9 | Molecular Weight | 244.042 | |
| Density | 1.6±0.1 g/cm3 | Boiling Point | 275.4±25.0 °C at 760 mmHg | |
| Molecular Formula | C8H6BrNO3 | Melting Point | 117-121 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 120.4±23.2 °C | |
| Name | 1-(4-bromo-3-nitrophenyl)ethanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Boiling Point | 275.4±25.0 °C at 760 mmHg |
| Melting Point | 117-121 °C(lit.) |
| Molecular Formula | C8H6BrNO3 |
| Molecular Weight | 244.042 |
| Flash Point | 120.4±23.2 °C |
| Exact Mass | 242.953094 |
| PSA | 62.89000 |
| LogP | 2.06 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.593 |
| InChIKey | YFVOFFKNHQTQQE-UHFFFAOYSA-N |
| SMILES | CC(=O)c1ccc(Br)c([N+](=O)[O-])c1 |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| Hazard Codes | Xn:Harmful; |
| Risk Phrases | R20/21/22 |
| Safety Phrases | S24/25 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2914700090 |
| Precursor 3 | |
|---|---|
| DownStream 6 | |
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| 4‘-Bromo-3‘-nitroacetophenone |
| 1-(4-Bromo-3-nitrophenyl)ethanone |
| 3-nitro-4-bromoacetophenone |
| Ethanone, 1-(4-bromo-3-nitrophenyl)- |
| EINECS 242-469-6 |
| 4-bromo-3'-nitroacetophenone |
| 4'-Bromo-3'-nitroacetophenone |
| 1-bromo-2-nitro-4-acetyl-benzene |
| MFCD00016985 |