2-[[2-(Diethylamino)ethyl]thio]-3-phenylquinazolin-4(3H)-one structure
|
Common Name | 2-[[2-(Diethylamino)ethyl]thio]-3-phenylquinazolin-4(3H)-one | ||
|---|---|---|---|---|
| CAS Number | 18619-72-2 | Molecular Weight | 353.48100 | |
| Density | 1.15g/cm3 | Boiling Point | 497.4ºC at 760 mmHg | |
| Molecular Formula | C20H23N3OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 254.6ºC | |
| Name | 2-[2-(diethylamino)ethylsulfanyl]-3-phenylquinazolin-4-one |
|---|
| Density | 1.15g/cm3 |
|---|---|
| Boiling Point | 497.4ºC at 760 mmHg |
| Molecular Formula | C20H23N3OS |
| Molecular Weight | 353.48100 |
| Flash Point | 254.6ºC |
| Exact Mass | 353.15600 |
| PSA | 63.43000 |
| LogP | 3.81960 |
| Vapour Pressure | 4.95E-10mmHg at 25°C |
| Index of Refraction | 1.613 |
| InChIKey | XOBCSDULXSVUGF-UHFFFAOYSA-N |
| SMILES | CCN(CC)CCSc1nc2ccccc2c(=O)n1-c1ccccc1 |
| HS Code | 2933990090 |
|---|
|
~46%
2-[[2-(Diethyla... CAS#:18619-72-2 |
| Literature: Azev; Golomolzin; Dyulcks; Klyuev; Yatluk Chemistry of Heterocyclic Compounds, 2007 , vol. 43, # 3 p. 356 - 361 |
|
~33%
2-[[2-(Diethyla... CAS#:18619-72-2 |
| Literature: Nisshin Flour Milling Co., Ltd. Patent: US4861780 A1, 1989 ; |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |