1-[(2,3,6-trichlorophenyl)methoxy]propan-2-ol
Modify Date: 2025-08-28 13:29:36
![1-[(2,3,6-trichlorophenyl)methoxy]propan-2-ol Structure](https://image.chemsrc.com/caspic/099/1861-44-5.png)
1-[(2,3,6-trichlorophenyl)methoxy]propan-2-ol structure
|
Common Name | 1-[(2,3,6-trichlorophenyl)methoxy]propan-2-ol | ||
|---|---|---|---|---|
| CAS Number | 1861-44-5 | Molecular Weight | 269.55200 | |
| Density | 1.379g/cm3 | Boiling Point | 353.2ºC at 760mmHg | |
| Molecular Formula | C10H11Cl3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 167.4ºC | |
| Name | tritac |
|---|---|
| Synonym | More Synonyms |
| Density | 1.379g/cm3 |
|---|---|
| Boiling Point | 353.2ºC at 760mmHg |
| Molecular Formula | C10H11Cl3O2 |
| Molecular Weight | 269.55200 |
| Flash Point | 167.4ºC |
| Exact Mass | 267.98200 |
| PSA | 29.46000 |
| LogP | 3.54420 |
| Vapour Pressure | 1.35E-05mmHg at 25°C |
| Index of Refraction | 1.558 |
| InChIKey | LJWIIRATRWPHBA-UHFFFAOYSA-N |
| SMILES | CC(O)COCc1c(Cl)ccc(Cl)c1Cl |
| HS Code | 2909499000 |
|---|
| HS Code | 2909499000 |
|---|---|
| Summary | 2909499000. ether-alcohols and their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:9.0%. . MFN tariff:5.5%. General tariff:30.0% |
| rac-(2R)-1-[(2,3,6-trichlorophenyl)methoxy]propan-2-ol |
| HRS-587 |
| 1-[(2,3,6-trichlorophenyl)methoxy]propan-2-ol |
| (RS)-1-(2,3,6-trichlorobenzyloxy)propan-2-ol |
| Caswell No. 873B |
| 1-[(2,3,6-trichlorophenyl)methoxy]-2-propanol |