1,2,3,4-Tetrahydro-6-methoxy-2-methyl-1-(4-nitrophenethyl)isoquinoline structure
|
Common Name | 1,2,3,4-Tetrahydro-6-methoxy-2-methyl-1-(4-nitrophenethyl)isoquinoline | ||
|---|---|---|---|---|
| CAS Number | 63937-36-0 | Molecular Weight | 326.39000 | |
| Density | 1.159g/cm3 | Boiling Point | 480.5ºC at 760mmHg | |
| Molecular Formula | C19H22N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 244.4ºC | |
| Name | 6-methoxy-2-methyl-1-[2-(4-nitrophenyl)ethyl]-3,4-dihydro-1H-isoquinoline |
|---|
| Density | 1.159g/cm3 |
|---|---|
| Boiling Point | 480.5ºC at 760mmHg |
| Molecular Formula | C19H22N2O3 |
| Molecular Weight | 326.39000 |
| Flash Point | 244.4ºC |
| Exact Mass | 326.16300 |
| PSA | 58.29000 |
| LogP | 4.22630 |
| Index of Refraction | 1.58 |
| InChIKey | SIPXVTDBUYGIKR-UHFFFAOYSA-N |
| SMILES | COc1ccc2c(c1)CCN(C)C2CCc1ccc([N+](=O)[O-])cc1 |
| HS Code | 2933499090 |
|---|
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |