Mca-Pro-Leu-Gly-Pro-DLys: Dnp structure
|
Common Name | Mca-Pro-Leu-Gly-Pro-DLys: Dnp | ||
|---|---|---|---|---|
| CAS Number | 185698-23-1 | Molecular Weight | 892.90700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C42H52N8O14 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Mca-Pro-Leu-Gly-Pro-DLys: DnpMca-Pro-Leu-Gly-Pro-D-Lys(Dnp) is a FRET substrate of Thimet oligopeptidase. Mca-Pro-Leu-Gly-Pro-D-Lys(Dnp) can be used for the determination of Thimet oligopeptidase activity[1]. |
| Name | mca-pro-leu-gly-pro-d-lys(dnp)-oh |
|---|---|
| Synonym | More Synonyms |
| Description | Mca-Pro-Leu-Gly-Pro-D-Lys(Dnp) is a FRET substrate of Thimet oligopeptidase. Mca-Pro-Leu-Gly-Pro-D-Lys(Dnp) can be used for the determination of Thimet oligopeptidase activity[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C42H52N8O14 |
|---|---|
| Molecular Weight | 892.90700 |
| Exact Mass | 892.36000 |
| PSA | 308.33000 |
| LogP | 4.80930 |
| InChIKey | JYCBGGJXIFZMBU-GJBCSVNNSA-N |
| SMILES | COc1ccc2c(CC(=O)N3CCCC3C(=O)NC(CC(C)C)C(=O)NCC(=O)N3CCCC3C(=O)NC(CCCCNc3ccc([N+](=O)[O-])cc3[N+](=O)[O-])C(=O)O)cc(=O)oc2c1 |
| Mca-Pro-Leu-Gly-Pro-DLys: Dnp |