24RBPyBC
Modify Date: 2024-04-11 22:19:32
24RBPyBC structure
|
Common Name | 24RBPyBC | ||
|---|---|---|---|---|
| CAS Number | 185675-92-7 | Molecular Weight | 538.68 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C32H38N6O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of 24RBPyBC24RBPyBC is a dinucleating macrocyclic ligand, it contains phenolate pyridine, bipyridine, and amino groups form dinuclear Fe(II) and Fe(III) complexes[1][2]. |
| Name | 24RBPyBC |
|---|
| Description | 24RBPyBC is a dinucleating macrocyclic ligand, it contains phenolate pyridine, bipyridine, and amino groups form dinuclear Fe(II) and Fe(III) complexes[1][2]. |
|---|---|
| Related Catalog | |
| In Vitro | 24RBPyBC forms a dinuclear iron(II) complex, which reacts with molecular oxygen and catalyzes its insertion into C-H bond of adamantane in an acetonitrile solvent system containing pyridine and in the presence of hydrogen sulfide as a two-electron reductant[1]. |
| References |
| Molecular Formula | C32H38N6O2 |
|---|---|
| Molecular Weight | 538.68 |
| InChIKey | FWSXILLPHLXROP-UHFFFAOYSA-N |
| SMILES | Cc1cc2c(O)c(c1)CNCc1cccc(n1)CNCc1cc(C)cc(c1O)CNCc1cccc(n1)CNC2 |