Fmoc-Gly-Pro-Hyp-OH
Modify Date: 2025-08-23 18:31:50
Fmoc-Gly-Pro-Hyp-OH structure
|
Common Name | Fmoc-Gly-Pro-Hyp-OH | ||
|---|---|---|---|---|
| CAS Number | 185213-75-6 | Molecular Weight | 507.53500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C27H29N3O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Fmoc-Gly-Pro-Hyp-OHFmoc-Gly-Pro-Hyp-OH is a tripeptide that can be used in peptide synthesis[1]. |
| Name | Fmoc-Gly-Pro-Hyp-OH |
|---|
| Description | Fmoc-Gly-Pro-Hyp-OH is a tripeptide that can be used in peptide synthesis[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C27H29N3O7 |
|---|---|
| Molecular Weight | 507.53500 |
| Exact Mass | 507.20100 |
| PSA | 136.48000 |
| LogP | 2.17680 |
| InChIKey | PWGVGGAHJIWHRV-RJGXRXQPSA-N |
| SMILES | O=C(NCC(=O)N1CCCC1C(=O)N1C(O)CCC1C(=O)O)OCC1c2ccccc2-c2ccccc21 |