2,2′-Dihydroxy-4,6-dimethoxy-3-methylacetophenone structure
|
Common Name | 2,2′-Dihydroxy-4,6-dimethoxy-3-methylacetophenone | ||
|---|---|---|---|---|
| CAS Number | 184706-61-4 | Molecular Weight | 226.22600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H14O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of 2,2′-Dihydroxy-4,6-dimethoxy-3-methylacetophenone2,2′-Dihydroxy-4,6-dimethoxy-3-methylacetophenone can be isolated from the EtOAc extract of spurge stems. |
| Name | 2-hydroxy-1-(2-hydroxy-4,6-dimethoxy-3-methylphenyl)ethanone |
|---|
| Description | 2,2′-Dihydroxy-4,6-dimethoxy-3-methylacetophenone can be isolated from the EtOAc extract of spurge stems. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C11H14O5 |
|---|---|
| Molecular Weight | 226.22600 |
| Exact Mass | 226.08400 |
| PSA | 75.99000 |
| LogP | 0.89280 |
| InChIKey | GIXBAQKEJVBQMA-UHFFFAOYSA-N |
| SMILES | COc1cc(OC)c(C(=O)CO)c(O)c1C |