Boc-D-beta-hoMovaline structure
|
Common Name | Boc-D-beta-hoMovaline | ||
|---|---|---|---|---|
| CAS Number | 183990-64-9 | Molecular Weight | 231.289 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 360.4±25.0 °C at 760 mmHg | |
| Molecular Formula | C11H21NO4 | Melting Point | 115-120℃ | |
| MSDS | Chinese USA | Flash Point | 171.8±23.2 °C | |
| Name | (3R)-4-methyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 360.4±25.0 °C at 760 mmHg |
| Melting Point | 115-120℃ |
| Molecular Formula | C11H21NO4 |
| Molecular Weight | 231.289 |
| Flash Point | 171.8±23.2 °C |
| Exact Mass | 231.147064 |
| PSA | 75.63000 |
| LogP | 2.15 |
| Appearance of Characters | Solid |
| Vapour Pressure | 0.0±1.7 mmHg at 25°C |
| Index of Refraction | 1.461 |
| InChIKey | LUXMZCJCTUATDM-MRVPVSSYSA-N |
| SMILES | CC(C)C(CC(=O)O)NC(=O)OC(C)(C)C |
| Storage condition | Store at 0-5°C |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| Hazard Codes | Xi |
| Safety Phrases | S22-S24/25 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2924199090 |
| HS Code | 2924199090 |
|---|---|
| Summary | 2924199090. other acyclic amides (including acyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Pentanoic acid, 3-[[(1,1-dimethylethoxy)carbonyl]amino]-4-methyl-, (3R)- |
| (R)-3-((tert-Butoxycarbonyl)amino)-4-methylpentanoic acid |
| Boc-β-Leu-OH |
| (R)-3-{[(tert-butyl)carbonyl]amino}-4-methylpentanoic acid |
| (3R)-4-Methyl-3-({[(2-methyl-2-propanyl)oxy]carbonyl}amino)pentanoic acid |
| (3R)-3-[(tert-butoxycarbonyl)amino]-4-methylpentanoic acid |
| MFCD01076232 |
| (R)-N-Boc-3-Amino-4-methylpentanoic acid |
| Boc-D-beta-hoMovaline |
| (R)-3-[(tert-Butoxycarbonyl)amino]-4-methylpentanoic acid |
| Boc-L-beta-HoMovaline |