2-tert-butyl-4,6-dihydroxypyrimidine structure
|
Common Name | 2-tert-butyl-4,6-dihydroxypyrimidine | ||
|---|---|---|---|---|
| CAS Number | 18378-79-5 | Molecular Weight | 168.19300 | |
| Density | 1.2g/cm3 | Boiling Point | 311ºC at 760 mmHg | |
| Molecular Formula | C8H12N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 141.9ºC | |
| Name | 2-tert-butyl-4-hydroxy-1H-pyrimidin-6-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2g/cm3 |
|---|---|
| Boiling Point | 311ºC at 760 mmHg |
| Molecular Formula | C8H12N2O2 |
| Molecular Weight | 168.19300 |
| Flash Point | 141.9ºC |
| Exact Mass | 168.09000 |
| PSA | 66.24000 |
| LogP | 1.18530 |
| Vapour Pressure | 0.000317mmHg at 25°C |
| Index of Refraction | 1.553 |
| InChIKey | HRVWBFSYFICPAS-UHFFFAOYSA-N |
| SMILES | CC(C)(C)c1nc(O)cc(=O)[nH]1 |
| HS Code | 2933599090 |
|---|
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-t-Butyl-4,6-dihydroxypyrimidin |
| 2-tert-Butyl-4,6-pyrimidinediol |
| 2-tert-butyl-1H-pyrimidine-4,6-dione |
| 2-TERT-BUTYL-4,6-DIHYDROXYPYRIMIDINE |
| 2-t-butylpyrimidine-4,6-diol |
| 2-tert-butylpyrimidine-4,6-diol |
| 4,6-dihydroxy-2-tert-butyl-pyrimidine |