Acetamide, N-ethyl-N-(4-nitrophenyl)-
Acetamide, N-ethyl-N-(4-nitrophenyl)- structure
|
Common Name | Acetamide, N-ethyl-N-(4-nitrophenyl)- | ||
|---|---|---|---|---|
| CAS Number | 1826-56-8 | Molecular Weight | 208.21400 | |
| Density | 1.229g/cm3 | Boiling Point | 353.8ºC at 760 mmHg | |
| Molecular Formula | C10H12N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 167.8ºC | |
| Name | N-ethyl-N-(4-nitrophenyl)acetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.229g/cm3 |
|---|---|
| Boiling Point | 353.8ºC at 760 mmHg |
| Molecular Formula | C10H12N2O3 |
| Molecular Weight | 208.21400 |
| Flash Point | 167.8ºC |
| Exact Mass | 208.08500 |
| PSA | 66.13000 |
| LogP | 2.49080 |
| Vapour Pressure | 3.49E-05mmHg at 25°C |
| Index of Refraction | 1.58 |
| InChIKey | POGUNGMMMFNPOE-UHFFFAOYSA-N |
| SMILES | CCN(C(C)=O)c1ccc([N+](=O)[O-])cc1 |
| HS Code | 2924299090 |
|---|
|
~%
Acetamide, N-et... CAS#:1826-56-8 |
| Literature: Novartis AG Patent: US6589950 B1, 2003 ; |
|
~%
Acetamide, N-et... CAS#:1826-56-8 |
| Literature: Weller Chemische Berichte, 1883 , vol. 16, p. 31 |
|
~%
Acetamide, N-et... CAS#:1826-56-8 |
| Literature: Meldola; Salmon Journal of the Chemical Society, 1888 , vol. 53, p. 779 |
|
~%
Acetamide, N-et... CAS#:1826-56-8 |
| Literature: Latif; Sattar Journal of the Indian Chemical Society, 1955 , vol. 32, p. 489 |
|
~%
Acetamide, N-et... CAS#:1826-56-8 |
| Literature: Weller Chemische Berichte, 1883 , vol. 16, p. 31 |
|
~%
Acetamide, N-et... CAS#:1826-56-8 |
| Literature: Noelting; Collin Chemische Berichte, 1884 , vol. 17, p. 265 |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| N-Aethyl-4-nitro-acetanilid |
| AC1L2M7R |
| acetic acid-(N-ethyl-4-nitro-anilide) |
| N-acetyl-N-ethyl-4nitroaniline |
| AR-1K6979 |
| N-Ethyl-4'-nitroacetanilid |
| Essigsaeure-(N-aethyl-4-nitro-anilid) |
| AC1Q1ZI2 |
| N-ethyl-N-(4-nitrophenyl)-acetamide |
| N-ETHYL-4'-NITROACETANILIDE |