CXCR2 antagonist 8
Modify Date: 2025-11-25 20:36:12
CXCR2 antagonist 8 structure
|
Common Name | CXCR2 antagonist 8 | ||
|---|---|---|---|---|
| CAS Number | 182498-30-2 | Molecular Weight | 303.27 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H13N3O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of CXCR2 antagonist 8CXCR2 antagonist 8 is a potent and selective CXCR2 antagonist. CXCR2 antagonist 8 can be used for insulin resistance research[1]. |
| Name | CXCR2 antagonist 8 |
|---|
| Description | CXCR2 antagonist 8 is a potent and selective CXCR2 antagonist. CXCR2 antagonist 8 can be used for insulin resistance research[1]. |
|---|---|
| Related Catalog | |
| Target |
CXCR2 |
| References |
| Molecular Formula | C14H13N3O5 |
|---|---|
| Molecular Weight | 303.27 |
| InChIKey | KNPLCJZGNRGZAN-UHFFFAOYSA-N |
| SMILES | COc1ccccc1NC(=O)Nc1ccc([N+](=O)[O-])cc1O |