5-(bicycloheptenyl)methyldichlorosilane structure
|
Common Name | 5-(bicycloheptenyl)methyldichlorosilane | ||
|---|---|---|---|---|
| CAS Number | 18245-94-8 | Molecular Weight | 207.17200 | |
| Density | 1.16g/cm3 | Boiling Point | 219.7ºC at 760mmHg | |
| Molecular Formula | C8H12Cl2Si | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 82.2ºC | |
| Name | 5-(bicycloheptenyl)methyldichlorosilane |
|---|
| Density | 1.16g/cm3 |
|---|---|
| Boiling Point | 219.7ºC at 760mmHg |
| Molecular Formula | C8H12Cl2Si |
| Molecular Weight | 207.17200 |
| Flash Point | 82.2ºC |
| Exact Mass | 206.00900 |
| LogP | 3.50220 |
| Vapour Pressure | 0.000107mmHg at 25°C |
| Index of Refraction | 1.4938 |
| InChIKey | LYTATDHKONFXEH-UHFFFAOYSA-N |
| SMILES | C[Si](Cl)(Cl)C1CC2C=CC1C2 |
| Risk Phrases | 34 |
|---|---|
| Safety Phrases | 26-36/37/39 |
| RIDADR | UN 2987 |
| HS Code | 2931900090 |
|
~%
5-(bicyclohepte... CAS#:18245-94-8 |
| Literature: Petrov,A.D. et al. J. Gen. Chem. USSR (Engl. Transl.), 1961 , vol. 31, # 4 p. 1199 - 1208,1109 - 1117 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |