N,N'-Dimethyl-1,1'-biadamantane-3,3'-diamine structure
|
Common Name | N,N'-Dimethyl-1,1'-biadamantane-3,3'-diamine | ||
|---|---|---|---|---|
| CAS Number | 18220-69-4 | Molecular Weight | 328.53500 | |
| Density | 1.1g/cm3 | Boiling Point | 388.6ºC at 760 mmHg | |
| Molecular Formula | C22H36N2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 209ºC | |
| Name | N-methyl-3-[3-(methylamino)-1-adamantyl]adamantan-1-amine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1g/cm3 |
|---|---|
| Boiling Point | 388.6ºC at 760 mmHg |
| Molecular Formula | C22H36N2 |
| Molecular Weight | 328.53500 |
| Flash Point | 209ºC |
| Exact Mass | 328.28800 |
| PSA | 24.06000 |
| LogP | 4.88500 |
| Vapour Pressure | 3.03E-06mmHg at 25°C |
| Index of Refraction | 1.581 |
| InChIKey | RFZPLLLYXVWISV-UHFFFAOYSA-N |
| SMILES | CNC12CC3CC(C1)CC(C14CC5CC(CC(NC)(C5)C1)C4)(C3)C2 |
| HS Code | 2921300090 |
|---|
| HS Code | 2921300090 |
|---|---|
| Summary | 2921300090 other cyclanic, cyclenic or cyclotherpenic mono- or polyamines, and their derivatives; salts thereof。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| N,N'-Dimethyl-1,1'-biadamantane-3,3'-diamine |
| 3,3'-Bis-methylamino-1,1'-biadamantyl |
| 3.3'-Bis-<N-methyl-amino>-<1.1'-biadamantan> |
| 1,1'-BIADAMANTANE-3,3'-DIAMINE,N,N'-DIMETHYL |