1,1'-Biadamantane-3,3'-diamine
Modify Date: 2025-08-25 21:32:10
1,1'-Biadamantane-3,3'-diamine structure
|
Common Name | 1,1'-Biadamantane-3,3'-diamine | ||
|---|---|---|---|---|
| CAS Number | 18220-68-3 | Molecular Weight | 300.48100 | |
| Density | 1.217g/cm3 | Boiling Point | 379.7ºC at 760 mmHg | |
| Molecular Formula | C20H32N2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 219ºC | |
| Name | 3-(3-amino-1-adamantyl)adamantan-1-amine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.217g/cm3 |
|---|---|
| Boiling Point | 379.7ºC at 760 mmHg |
| Molecular Formula | C20H32N2 |
| Molecular Weight | 300.48100 |
| Flash Point | 219ºC |
| Exact Mass | 300.25700 |
| PSA | 52.04000 |
| LogP | 4.98240 |
| Vapour Pressure | 5.74E-06mmHg at 25°C |
| Index of Refraction | 1.642 |
| InChIKey | SOKRCBPOBAYQBS-UHFFFAOYSA-N |
| SMILES | NC12CC3CC(C1)CC(C14CC5CC(CC(N)(C5)C1)C4)(C3)C2 |
| HS Code | 2921300090 |
|---|
| HS Code | 2921300090 |
|---|---|
| Summary | 2921300090 other cyclanic, cyclenic or cyclotherpenic mono- or polyamines, and their derivatives; salts thereof。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| 1,1'-BIADAMANTANE-3,3'-DIAMINE |
| 3,3'-diamino-1,1'-diadamantyl |
| 3,3'-Diamino-1,1'-biadamantyl |
| 1,1'-Biadamantane,3,3'-diamino |
| 3,3'-Diamino-1,1'-biadamantan |