1,1,3,3-Tetramethoxy-1,3-dimethyldisiloxane structure
|
Common Name | 1,1,3,3-Tetramethoxy-1,3-dimethyldisiloxane | ||
|---|---|---|---|---|
| CAS Number | 18186-97-5 | Molecular Weight | 226.375 | |
| Density | 1.0±0.1 g/cm3 | Boiling Point | 144.4±23.0 °C at 760 mmHg | |
| Molecular Formula | C6H18O5Si2 | Melting Point | <0ºC | |
| MSDS | N/A | Flash Point | 32.8±23.0 °C | |
| Name | 1,3-dimethyltetramethoxydisiloxane |
|---|---|
| Synonym | More Synonyms |
| Density | 1.0±0.1 g/cm3 |
|---|---|
| Boiling Point | 144.4±23.0 °C at 760 mmHg |
| Melting Point | <0ºC |
| Molecular Formula | C6H18O5Si2 |
| Molecular Weight | 226.375 |
| Flash Point | 32.8±23.0 °C |
| Exact Mass | 226.069275 |
| PSA | 46.15000 |
| LogP | 4.76 |
| Vapour Pressure | 6.4±0.3 mmHg at 25°C |
| Index of Refraction | 1.400 |
| InChIKey | JWVHPGDCFVOYMQ-UHFFFAOYSA-N |
| SMILES | CO[Si](C)(OC)O[Si](C)(OC)OC |
|
~%
1,1,3,3-Tetrame... CAS#:18186-97-5 |
| Literature: Journal of the American Chemical Society, , vol. 77, p. 4173 |
|
~18%
1,1,3,3-Tetrame... CAS#:18186-97-5 |
| Literature: Gmelin Handbook: Si: MVol.C, 92, page 252 - 253 |
|
~0%
1,1,3,3-Tetrame... CAS#:18186-97-5
Detail
|
| Literature: Journal of Organic Chemistry, , vol. 17, p. 1400 - 1404 |
|
~%
1,1,3,3-Tetrame... CAS#:18186-97-5 |
| Literature: Technology Reports of the Osaka University, , vol. 7, p. 193,194,196 Journal of Organic Chemistry, , vol. 17, p. 1397 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1,3-dimethyl-1,1,3,3-tetramethoxydisiloxane |
| 1 3-DIMETHYLTETRAMETHOXYDISILOXANE |
| Disiloxane, 1,3-dimethyl-1,1,3,3-tetramethoxy-, |
| 1,1,3,3-Tetramethoxy-1,3-dimethylpropanedisiloxane |
| TETRAMETHOXY-1,3-DIMETHYLDISILOXANE |
| EINECS 242-072-8 |
| 1,1,3,3-Tetramethoxy-1,3-dimethyldisiloxane |
| dimethyltetramethoxydisiloxane |
| 1,1,3,3-tetramethoxy-1,3-dimethyl-disiloxane |
| MFCD00040017 |
| Disiloxane, 1,1,3,3-tetramethoxy-1,3-dimethyl- |
| Disiloxane,1,1,3,3-tetramethoxy-1,3-dimethyl |
| 1,1,3,3-Tetramethoxy-1,3-dimethyl-disiloxan |