Benzoic acid,2-hydroxy-, 2-[(2-methoxyphenyl)methylene]hydrazide
Modify Date: 2025-08-20 16:18:05
![Benzoic acid,2-hydroxy-, 2-[(2-methoxyphenyl)methylene]hydrazide Structure](https://image.chemsrc.com/caspic/244/18176-35-7.png)
Benzoic acid,2-hydroxy-, 2-[(2-methoxyphenyl)methylene]hydrazide structure
|
Common Name | Benzoic acid,2-hydroxy-, 2-[(2-methoxyphenyl)methylene]hydrazide | ||
|---|---|---|---|---|
| CAS Number | 18176-35-7 | Molecular Weight | 270.28300 | |
| Density | 1.19g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C15H14N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-hydroxy-N-[(Z)-(2-methoxyphenyl)methylideneamino]benzamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.19g/cm3 |
|---|---|
| Molecular Formula | C15H14N2O3 |
| Molecular Weight | 270.28300 |
| Exact Mass | 270.10000 |
| PSA | 70.92000 |
| LogP | 2.55560 |
| Index of Refraction | 1.581 |
| InChIKey | HCQWOCUPHAMYRB-YBEGLDIGSA-N |
| SMILES | COc1ccccc1C=NNC(=O)c1ccccc1O |
| HS Code | 2928000090 |
|---|
|
~%
Benzoic acid,2-... CAS#:18176-35-7 |
| Literature: Singh; Gurtu; Kumar; Sinha; Bhargava; Shanker Archiv der Pharmazie, 1984 , vol. 317, # 7 p. 609 - 614 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
![N-[3-chloro-2-(2-methoxyphenyl)-4-oxo-azetidin-1-yl]-2-hydroxy-benzami de structure](https://image.chemsrc.com/caspic/301/87444-09-5.png)
CAS#:87444-09-5| HS Code | 2928000090 |
|---|---|
| Summary | 2928000090 other organic derivatives of hydrazine or of hydroxylamine VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| 2-Methoxy-benzaldehyd-salicyloylhydrazon |
| N-Salicyloyl-N'-<2-methoxy-benzyliden>-hydrazin |